C14H17N3O3S — CID 135880752
N-(cyclobutylmethyl)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]acetamide (PubChem CID 135880752) has the molecular formula C14H17N3O3S and a molecular weight of 307.37 g/mol. Its IUPAC name is N-(cyclobutylmethyl)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]acetamide.
| Compound Name | N-(cyclobutylmethyl)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]acetamide |
|---|---|
| PubChem CID | 135880752 |
| Molecular Formula | C14H17N3O3S |
| Molecular Weight | 307.37 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | N-(cyclobutylmethyl)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]acetamide |
| SMILES | O=C(C/N=C1\NS(=O)(=O)c2ccccc21)NCC1CCC1 |
| InChI | InChI=1S/C14H17N3O3S/c18-13(15-8-10-4-3-5-10)9-16-14-11-6-1-2-7-12(11)21(19,20)17-14/h1-2,6-7,10H,3-5,8-9H2,(H,15,18)(H,16,17) |
| InChIKey | NVWXJWOSCVWBEA-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 87.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.37 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|