C18H18N4O4S — CID 135858581
N-[2-[[2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]acetyl]amino]ethyl]benzamide (PubChem CID 135858581) has the molecular formula C18H18N4O4S and a molecular weight of 386.43 g/mol. Its IUPAC name is N-[2-[[2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]acetyl]amino]ethyl]benzamide.
| Compound Name | N-[2-[[2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]acetyl]amino]ethyl]benzamide |
|---|---|
| PubChem CID | 135858581 |
| Molecular Formula | C18H18N4O4S |
| Molecular Weight | 386.43 g/mol |
| Exact Mass | 386.10 |
| IUPAC Name | N-[2-[[2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]acetyl]amino]ethyl]benzamide |
| SMILES | O=C(C/N=C1\NS(=O)(=O)c2ccccc21)NCCNC(=O)c1ccccc1 |
| InChI | InChI=1S/C18H18N4O4S/c23-16(19-10-11-20-18(24)13-6-2-1-3-7-13)12-21-17-14-8-4-5-9-15(14)27(25,26)22-17/h1-9H,10-12H2,(H,19,23)(H,20,24)(H,21,22) |
| InChIKey | ZFMBPHVOTSXGCW-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 116.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.43 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|