C16H23N3O4S — CID 154750677
N-(3-butoxypropyl)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]acetamide (PubChem CID 154750677) has the molecular formula C16H23N3O4S and a molecular weight of 353.44 g/mol. Its IUPAC name is N-(3-butoxypropyl)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]acetamide.
| Compound Name | N-(3-butoxypropyl)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]acetamide |
|---|---|
| PubChem CID | 154750677 |
| Molecular Formula | C16H23N3O4S |
| Molecular Weight | 353.44 g/mol |
| Exact Mass | 353.14 |
| IUPAC Name | N-(3-butoxypropyl)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]acetamide |
| SMILES | CCCCOCCCNC(=O)C/N=C1\NS(=O)(=O)c2ccccc21 |
| InChI | InChI=1S/C16H23N3O4S/c1-2-3-10-23-11-6-9-17-15(20)12-18-16-13-7-4-5-8-14(13)24(21,22)19-16/h4-5,7-8H,2-3,6,9-12H2,1H3,(H,17,20)(H,18,19) |
| InChIKey | GBXNROBWLDRXLA-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 96.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.44 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|