C15H22N4O3S — CID 137078563
N-(2-amino-2-ethylbutyl)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]acetamide (PubChem CID 137078563) has the molecular formula C15H22N4O3S and a molecular weight of 338.43 g/mol. Its IUPAC name is N-(2-amino-2-ethylbutyl)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]acetamide.
| Compound Name | N-(2-amino-2-ethylbutyl)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]acetamide |
|---|---|
| PubChem CID | 137078563 |
| Molecular Formula | C15H22N4O3S |
| Molecular Weight | 338.43 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | N-(2-amino-2-ethylbutyl)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]acetamide |
| SMILES | CCC(N)(CC)CNC(=O)C/N=C1\NS(=O)(=O)c2ccccc21 |
| InChI | InChI=1S/C15H22N4O3S/c1-3-15(16,4-2)10-18-13(20)9-17-14-11-7-5-6-8-12(11)23(21,22)19-14/h5-8H,3-4,9-10,16H2,1-2H3,(H,17,19)(H,18,20) |
| InChIKey | FAEYQEXVZDNTEQ-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 113.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.43 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|