C14H20N2O3S — CID 136713679
2-[[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]methyl]-2-ethylbutan-1-ol (PubChem CID 136713679) has the molecular formula C14H20N2O3S and a molecular weight of 296.39 g/mol. Its IUPAC name is 2-[[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]methyl]-2-ethylbutan-1-ol.
| Compound Name | 2-[[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]methyl]-2-ethylbutan-1-ol |
|---|---|
| PubChem CID | 136713679 |
| Molecular Formula | C14H20N2O3S |
| Molecular Weight | 296.39 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | 2-[[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]methyl]-2-ethylbutan-1-ol |
| SMILES | CCC(CC)(CO)C/N=C1\NS(=O)(=O)c2ccccc21 |
| InChI | InChI=1S/C14H20N2O3S/c1-3-14(4-2,10-17)9-15-13-11-7-5-6-8-12(11)20(18,19)16-13/h5-8,17H,3-4,9-10H2,1-2H3,(H,15,16) |
| InChIKey | KAKXPQSTVDYEAC-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 78.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.39 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|