C11H12N2O4S — CID 135399643
2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-2-methylpropanoic acid (PubChem CID 135399643) has the molecular formula C11H12N2O4S and a molecular weight of 268.29 g/mol. Its IUPAC name is 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-2-methylpropanoic acid.
| Compound Name | 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 135399643 |
| Molecular Formula | C11H12N2O4S |
| Molecular Weight | 268.29 g/mol |
| Exact Mass | 268.05 |
| IUPAC Name | 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-2-methylpropanoic acid |
| SMILES | CC(C)(/N=C1\NS(=O)(=O)c2ccccc21)C(=O)O |
| InChI | InChI=1S/C11H12N2O4S/c1-11(2,10(14)15)12-9-7-5-3-4-6-8(7)18(16,17)13-9/h3-6H,1-2H3,(H,12,13)(H,14,15) |
| InChIKey | NULMNTIOYXLIQK-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 95.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.29 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|