C14H12N2O2S — CID 135401644
N-benzyl-1,1-dioxo-1,2-benzothiazol-3-imine (PubChem CID 135401644) has the molecular formula C14H12N2O2S and a molecular weight of 272.33 g/mol. Its IUPAC name is N-benzyl-1,1-dioxo-1,2-benzothiazol-3-imine.
| Compound Name | N-benzyl-1,1-dioxo-1,2-benzothiazol-3-imine |
|---|---|
| PubChem CID | 135401644 |
| Molecular Formula | C14H12N2O2S |
| Molecular Weight | 272.33 g/mol |
| Exact Mass | 272.06 |
| IUPAC Name | N-benzyl-1,1-dioxo-1,2-benzothiazol-3-imine |
| SMILES | O=S1(=O)N/C(=N\Cc2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C14H12N2O2S/c17-19(18)13-9-5-4-8-12(13)14(16-19)15-10-11-6-2-1-3-7-11/h1-9H,10H2,(H,15,16) |
| InChIKey | KOHXVVACOFWROT-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.33 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|