C14H11N3O4S — CID 135401812
N-benzyl-6-nitro-1,1-dioxo-1,2-benzothiazol-3-imine (PubChem CID 135401812) has the molecular formula C14H11N3O4S and a molecular weight of 317.33 g/mol. Its IUPAC name is N-benzyl-6-nitro-1,1-dioxo-1,2-benzothiazol-3-imine.
| Compound Name | N-benzyl-6-nitro-1,1-dioxo-1,2-benzothiazol-3-imine |
|---|---|
| PubChem CID | 135401812 |
| Molecular Formula | C14H11N3O4S |
| Molecular Weight | 317.33 g/mol |
| Exact Mass | 317.05 |
| IUPAC Name | N-benzyl-6-nitro-1,1-dioxo-1,2-benzothiazol-3-imine |
| SMILES | O=[N+]([O-])c1ccc2c(c1)S(=O)(=O)N/C2=N\Cc1ccccc1 |
| InChI | InChI=1S/C14H11N3O4S/c18-17(19)11-6-7-12-13(8-11)22(20,21)16-14(12)15-9-10-4-2-1-3-5-10/h1-8H,9H2,(H,15,16) |
| InChIKey | NMXHWBJFXJQAFO-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 101.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.33 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|