C8H7N3O4S — CID 150387019
N-methyl-6-nitro-1,1-dioxo-1,2-benzothiazol-3-imine (PubChem CID 150387019) has the molecular formula C8H7N3O4S and a molecular weight of 241.23 g/mol. Its IUPAC name is N-methyl-6-nitro-1,1-dioxo-1,2-benzothiazol-3-imine.
| Compound Name | N-methyl-6-nitro-1,1-dioxo-1,2-benzothiazol-3-imine |
|---|---|
| PubChem CID | 150387019 |
| Molecular Formula | C8H7N3O4S |
| Molecular Weight | 241.23 g/mol |
| Exact Mass | 241.02 |
| IUPAC Name | N-methyl-6-nitro-1,1-dioxo-1,2-benzothiazol-3-imine |
| SMILES | C/N=C1\NS(=O)(=O)c2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C8H7N3O4S/c1-9-8-6-3-2-5(11(12)13)4-7(6)16(14,15)10-8/h2-4H,1H3,(H,9,10) |
| InChIKey | HAXFYBOMBLYQFH-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 101.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.23 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|