C13H17N3O5S — CID 135634827
N-(2-butoxyethyl)-6-nitro-1,1-dioxo-1,2-benzothiazol-3-imine (PubChem CID 135634827) has the molecular formula C13H17N3O5S and a molecular weight of 327.36 g/mol. Its IUPAC name is N-(2-butoxyethyl)-6-nitro-1,1-dioxo-1,2-benzothiazol-3-imine.
| Compound Name | N-(2-butoxyethyl)-6-nitro-1,1-dioxo-1,2-benzothiazol-3-imine |
|---|---|
| PubChem CID | 135634827 |
| Molecular Formula | C13H17N3O5S |
| Molecular Weight | 327.36 g/mol |
| Exact Mass | 327.09 |
| IUPAC Name | N-(2-butoxyethyl)-6-nitro-1,1-dioxo-1,2-benzothiazol-3-imine |
| SMILES | CCCCOCC/N=C1\NS(=O)(=O)c2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C13H17N3O5S/c1-2-3-7-21-8-6-14-13-11-5-4-10(16(17)18)9-12(11)22(19,20)15-13/h4-5,9H,2-3,6-8H2,1H3,(H,14,15) |
| InChIKey | DWZWUKGXLJHFNC-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 110.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.36 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|