C11H12F2N2O3S — CID 136886325
N-[2-(2,2-difluoroethoxy)ethyl]-1,1-dioxo-1,2-benzothiazol-3-imine (PubChem CID 136886325) has the molecular formula C11H12F2N2O3S and a molecular weight of 290.29 g/mol. Its IUPAC name is N-[2-(2,2-difluoroethoxy)ethyl]-1,1-dioxo-1,2-benzothiazol-3-imine.
| Compound Name | N-[2-(2,2-difluoroethoxy)ethyl]-1,1-dioxo-1,2-benzothiazol-3-imine |
|---|---|
| PubChem CID | 136886325 |
| Molecular Formula | C11H12F2N2O3S |
| Molecular Weight | 290.29 g/mol |
| Exact Mass | 290.05 |
| IUPAC Name | N-[2-(2,2-difluoroethoxy)ethyl]-1,1-dioxo-1,2-benzothiazol-3-imine |
| SMILES | O=S1(=O)N/C(=N\CCOCC(F)F)c2ccccc21 |
| InChI | InChI=1S/C11H12F2N2O3S/c12-10(13)7-18-6-5-14-11-8-3-1-2-4-9(8)19(16,17)15-11/h1-4,10H,5-7H2,(H,14,15) |
| InChIKey | QPMFARFDJCMMOA-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.29 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|