C18H20N2O3S — CID 137263088
N-[3-(4-methoxyphenyl)butyl]-1,1-dioxo-1,2-benzothiazol-3-imine (PubChem CID 137263088) has the molecular formula C18H20N2O3S and a molecular weight of 344.44 g/mol. Its IUPAC name is N-[3-(4-methoxyphenyl)butyl]-1,1-dioxo-1,2-benzothiazol-3-imine.
| Compound Name | N-[3-(4-methoxyphenyl)butyl]-1,1-dioxo-1,2-benzothiazol-3-imine |
|---|---|
| PubChem CID | 137263088 |
| Molecular Formula | C18H20N2O3S |
| Molecular Weight | 344.44 g/mol |
| Exact Mass | 344.12 |
| IUPAC Name | N-[3-(4-methoxyphenyl)butyl]-1,1-dioxo-1,2-benzothiazol-3-imine |
| SMILES | COc1ccc(C(C)CC/N=C2\NS(=O)(=O)c3ccccc32)cc1 |
| InChI | InChI=1S/C18H20N2O3S/c1-13(14-7-9-15(23-2)10-8-14)11-12-19-18-16-5-3-4-6-17(16)24(21,22)20-18/h3-10,13H,11-12H2,1-2H3,(H,19,20) |
| InChIKey | VWOVTXFCILGUIM-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.44 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|