C18H18N2O6S — CID 135428340
2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]ethyl 3,5-dimethoxybenzoate (PubChem CID 135428340) has the molecular formula C18H18N2O6S and a molecular weight of 390.42 g/mol. Its IUPAC name is 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]ethyl 3,5-dimethoxybenzoate.
| Compound Name | 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]ethyl 3,5-dimethoxybenzoate |
|---|---|
| PubChem CID | 135428340 |
| Molecular Formula | C18H18N2O6S |
| Molecular Weight | 390.42 g/mol |
| Exact Mass | 390.09 |
| IUPAC Name | 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]ethyl 3,5-dimethoxybenzoate |
| SMILES | COc1cc(OC)cc(C(=O)OCC/N=C2\NS(=O)(=O)c3ccccc32)c1 |
| InChI | InChI=1S/C18H18N2O6S/c1-24-13-9-12(10-14(11-13)25-2)18(21)26-8-7-19-17-15-5-3-4-6-16(15)27(22,23)20-17/h3-6,9-11H,7-8H2,1-2H3,(H,19,20) |
| InChIKey | SVUSDSBYQMHXLK-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 103.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.42 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|