C20H20N2O6S — CID 135909020
methyl 3-[4-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]butanoyloxymethyl]benzoate (PubChem CID 135909020) has the molecular formula C20H20N2O6S and a molecular weight of 416.46 g/mol. Its IUPAC name is methyl 3-[4-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]butanoyloxymethyl]benzoate.
| Compound Name | methyl 3-[4-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]butanoyloxymethyl]benzoate |
|---|---|
| PubChem CID | 135909020 |
| Molecular Formula | C20H20N2O6S |
| Molecular Weight | 416.46 g/mol |
| Exact Mass | 416.10 |
| IUPAC Name | methyl 3-[4-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]butanoyloxymethyl]benzoate |
| SMILES | COC(=O)c1cccc(COC(=O)CCC/N=C2\NS(=O)(=O)c3ccccc32)c1 |
| InChI | InChI=1S/C20H20N2O6S/c1-27-20(24)15-7-4-6-14(12-15)13-28-18(23)10-5-11-21-19-16-8-2-3-9-17(16)29(25,26)22-19/h2-4,6-9,12H,5,10-11,13H2,1H3,(H,21,22) |
| InChIKey | QBINCGNSSASQAN-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 111.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.46 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|