C24H24N2O4S — CID 135925632
naphthalen-1-ylmethyl 6-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]hexanoate (PubChem CID 135925632) has the molecular formula C24H24N2O4S and a molecular weight of 436.53 g/mol. Its IUPAC name is naphthalen-1-ylmethyl 6-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]hexanoate.
| Compound Name | naphthalen-1-ylmethyl 6-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]hexanoate |
|---|---|
| PubChem CID | 135925632 |
| Molecular Formula | C24H24N2O4S |
| Molecular Weight | 436.53 g/mol |
| Exact Mass | 436.15 |
| IUPAC Name | naphthalen-1-ylmethyl 6-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]hexanoate |
| SMILES | O=C(CCCCC/N=C1\NS(=O)(=O)c2ccccc21)OCc1cccc2ccccc12 |
| InChI | InChI=1S/C24H24N2O4S/c27-23(30-17-19-11-8-10-18-9-3-4-12-20(18)19)15-2-1-7-16-25-24-21-13-5-6-14-22(21)31(28,29)26-24/h3-6,8-14H,1-2,7,15-17H2,(H,25,26) |
| InChIKey | JFTSAYISGRBBCV-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 84.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.53 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|