C24H25N3O5S — CID 135925634
[2-(2-methyl-1H-indol-3-yl)-2-oxoethyl] 6-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]hexanoate (PubChem CID 135925634) has the molecular formula C24H25N3O5S and a molecular weight of 467.55 g/mol. Its IUPAC name is [2-(2-methyl-1H-indol-3-yl)-2-oxoethyl] 6-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]hexanoate.
| Compound Name | [2-(2-methyl-1H-indol-3-yl)-2-oxoethyl] 6-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]hexanoate |
|---|---|
| PubChem CID | 135925634 |
| Molecular Formula | C24H25N3O5S |
| Molecular Weight | 467.55 g/mol |
| Exact Mass | 467.15 |
| IUPAC Name | [2-(2-methyl-1H-indol-3-yl)-2-oxoethyl] 6-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]hexanoate |
| SMILES | Cc1[nH]c2ccccc2c1C(=O)COC(=O)CCCCC/N=C1\NS(=O)(=O)c2ccccc21 |
| InChI | InChI=1S/C24H25N3O5S/c1-16-23(17-9-4-6-11-19(17)26-16)20(28)15-32-22(29)13-3-2-8-14-25-24-18-10-5-7-12-21(18)33(30,31)27-24/h4-7,9-12,26H,2-3,8,13-15H2,1H3,(H,25,27) |
| InChIKey | WQUQAULYMDEIGU-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 117.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.55 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|