C24H29N3O5S — CID 135925637
[2-(2,5-dimethyl-1-prop-2-enylpyrrol-3-yl)-2-oxoethyl] 6-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]hexanoate (PubChem CID 135925637) has the molecular formula C24H29N3O5S and a molecular weight of 471.58 g/mol. Its IUPAC name is [2-(2,5-dimethyl-1-prop-2-enylpyrrol-3-yl)-2-oxoethyl] 6-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]hexanoate.
| Compound Name | [2-(2,5-dimethyl-1-prop-2-enylpyrrol-3-yl)-2-oxoethyl] 6-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]hexanoate |
|---|---|
| PubChem CID | 135925637 |
| Molecular Formula | C24H29N3O5S |
| Molecular Weight | 471.58 g/mol |
| Exact Mass | 471.18 |
| IUPAC Name | [2-(2,5-dimethyl-1-prop-2-enylpyrrol-3-yl)-2-oxoethyl] 6-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]hexanoate |
| SMILES | C=CCn1c(C)cc(C(=O)COC(=O)CCCCC/N=C2\NS(=O)(=O)c3ccccc32)c1C |
| InChI | InChI=1S/C24H29N3O5S/c1-4-14-27-17(2)15-20(18(27)3)21(28)16-32-23(29)12-6-5-9-13-25-24-19-10-7-8-11-22(19)33(30,31)26-24/h4,7-8,10-11,15H,1,5-6,9,12-14,16H2,2-3H3,(H,25,26) |
| InChIKey | NIZYQHNAJRJQDA-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 106.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.58 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|