C24H22N4O6S — CID 135902951
[2-(1-benzamido-2,5-dimethylpyrrol-3-yl)-2-oxoethyl] 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]acetate (PubChem CID 135902951) has the molecular formula C24H22N4O6S and a molecular weight of 494.53 g/mol. Its IUPAC name is [2-(1-benzamido-2,5-dimethylpyrrol-3-yl)-2-oxoethyl] 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]acetate.
| Compound Name | [2-(1-benzamido-2,5-dimethylpyrrol-3-yl)-2-oxoethyl] 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]acetate |
|---|---|
| PubChem CID | 135902951 |
| Molecular Formula | C24H22N4O6S |
| Molecular Weight | 494.53 g/mol |
| Exact Mass | 494.13 |
| IUPAC Name | [2-(1-benzamido-2,5-dimethylpyrrol-3-yl)-2-oxoethyl] 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]acetate |
| SMILES | Cc1cc(C(=O)COC(=O)C/N=C2\NS(=O)(=O)c3ccccc32)c(C)n1NC(=O)c1ccccc1 |
| InChI | InChI=1S/C24H22N4O6S/c1-15-12-19(16(2)28(15)26-24(31)17-8-4-3-5-9-17)20(29)14-34-22(30)13-25-23-18-10-6-7-11-21(18)35(32,33)27-23/h3-12H,13-14H2,1-2H3,(H,25,27)(H,26,31) |
| InChIKey | PELVOHVDJLRMHO-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 135.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.53 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|