C22H24N2O5S — CID 135889373
[2-(2,5-diethylphenyl)-2-oxoethyl] 3-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propanoate (PubChem CID 135889373) has the molecular formula C22H24N2O5S and a molecular weight of 428.51 g/mol. Its IUPAC name is [2-(2,5-diethylphenyl)-2-oxoethyl] 3-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propanoate.
| Compound Name | [2-(2,5-diethylphenyl)-2-oxoethyl] 3-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propanoate |
|---|---|
| PubChem CID | 135889373 |
| Molecular Formula | C22H24N2O5S |
| Molecular Weight | 428.51 g/mol |
| Exact Mass | 428.14 |
| IUPAC Name | [2-(2,5-diethylphenyl)-2-oxoethyl] 3-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propanoate |
| SMILES | CCc1ccc(CC)c(C(=O)COC(=O)CC/N=C2\NS(=O)(=O)c3ccccc32)c1 |
| InChI | InChI=1S/C22H24N2O5S/c1-3-15-9-10-16(4-2)18(13-15)19(25)14-29-21(26)11-12-23-22-17-7-5-6-8-20(17)30(27,28)24-22/h5-10,13H,3-4,11-12,14H2,1-2H3,(H,23,24) |
| InChIKey | BHHZNRWLJDSZGH-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 101.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.51 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|