C19H18N2O6S — CID 135795623
ethyl 3-[3-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propanoyloxy]benzoate (PubChem CID 135795623) has the molecular formula C19H18N2O6S and a molecular weight of 402.43 g/mol. Its IUPAC name is ethyl 3-[3-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propanoyloxy]benzoate.
| Compound Name | ethyl 3-[3-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propanoyloxy]benzoate |
|---|---|
| PubChem CID | 135795623 |
| Molecular Formula | C19H18N2O6S |
| Molecular Weight | 402.43 g/mol |
| Exact Mass | 402.09 |
| IUPAC Name | ethyl 3-[3-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propanoyloxy]benzoate |
| SMILES | CCOC(=O)c1cccc(OC(=O)CC/N=C2\NS(=O)(=O)c3ccccc32)c1 |
| InChI | InChI=1S/C19H18N2O6S/c1-2-26-19(23)13-6-5-7-14(12-13)27-17(22)10-11-20-18-15-8-3-4-9-16(15)28(24,25)21-18/h3-9,12H,2,10-11H2,1H3,(H,20,21) |
| InChIKey | YPHBVBKUGPSBDA-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 111.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.43 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|