C23H21N3O8S — CID 135920859
[7-(ethoxycarbonylamino)-2-oxochromen-4-yl]methyl 3-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propanoate (PubChem CID 135920859) has the molecular formula C23H21N3O8S and a molecular weight of 499.50 g/mol. Its IUPAC name is [7-(ethoxycarbonylamino)-2-oxochromen-4-yl]methyl 3-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propanoate.
| Compound Name | [7-(ethoxycarbonylamino)-2-oxochromen-4-yl]methyl 3-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propanoate |
|---|---|
| PubChem CID | 135920859 |
| Molecular Formula | C23H21N3O8S |
| Molecular Weight | 499.50 g/mol |
| Exact Mass | 499.10 |
| IUPAC Name | [7-(ethoxycarbonylamino)-2-oxochromen-4-yl]methyl 3-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propanoate |
| SMILES | CCOC(=O)Nc1ccc2c(COC(=O)CC/N=C3\NS(=O)(=O)c4ccccc43)cc(=O)oc2c1 |
| InChI | InChI=1S/C23H21N3O8S/c1-2-32-23(29)25-15-7-8-16-14(11-21(28)34-18(16)12-15)13-33-20(27)9-10-24-22-17-5-3-4-6-19(17)35(30,31)26-22/h3-8,11-12H,2,9-10,13H2,1H3,(H,24,26)(H,25,29) |
| InChIKey | UWWQTYPTJUKLOU-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 153.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.50 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|