C25H20F2N2O7 — CID 46695701
[7-(ethoxycarbonylamino)-2-oxochromen-4-yl]methyl 3-[5-(2,6-difluorophenyl)-1,3-oxazol-2-yl]propanoate (PubChem CID 46695701) has the molecular formula C25H20F2N2O7 and a molecular weight of 498.44 g/mol. Its IUPAC name is [7-(ethoxycarbonylamino)-2-oxochromen-4-yl]methyl 3-[5-(2,6-difluorophenyl)-1,3-oxazol-2-yl]propanoate.
| Compound Name | [7-(ethoxycarbonylamino)-2-oxochromen-4-yl]methyl 3-[5-(2,6-difluorophenyl)-1,3-oxazol-2-yl]propanoate |
|---|---|
| PubChem CID | 46695701 |
| Molecular Formula | C25H20F2N2O7 |
| Molecular Weight | 498.44 g/mol |
| Exact Mass | 498.12 |
| IUPAC Name | [7-(ethoxycarbonylamino)-2-oxochromen-4-yl]methyl 3-[5-(2,6-difluorophenyl)-1,3-oxazol-2-yl]propanoate |
| SMILES | CCOC(=O)Nc1ccc2c(COC(=O)CCc3ncc(-c4c(F)cccc4F)o3)cc(=O)oc2c1 |
| InChI | InChI=1S/C25H20F2N2O7/c1-2-33-25(32)29-15-6-7-16-14(10-23(31)36-19(16)11-15)13-34-22(30)9-8-21-28-12-20(35-21)24-17(26)4-3-5-18(24)27/h3-7,10-12H,2,8-9,13H2,1H3,(H,29,32) |
| InChIKey | YOYJXPMRQNYDON-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 120.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.44 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|