C24H24N2O7S — CID 135935773
(7-methoxy-2-oxochromen-4-yl)methyl (2R)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]hexanoate (PubChem CID 135935773) has the molecular formula C24H24N2O7S and a molecular weight of 484.53 g/mol. Its IUPAC name is (7-methoxy-2-oxochromen-4-yl)methyl (2R)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]hexanoate.
| Compound Name | (7-methoxy-2-oxochromen-4-yl)methyl (2R)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]hexanoate |
|---|---|
| PubChem CID | 135935773 |
| Molecular Formula | C24H24N2O7S |
| Molecular Weight | 484.53 g/mol |
| Exact Mass | 484.13 |
| IUPAC Name | (7-methoxy-2-oxochromen-4-yl)methyl (2R)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]hexanoate |
| SMILES | CCCC[C@@H](/N=C1\NS(=O)(=O)c2ccccc21)C(=O)OCc1cc(=O)oc2cc(OC)ccc12 |
| InChI | InChI=1S/C24H24N2O7S/c1-3-4-8-19(25-23-18-7-5-6-9-21(18)34(29,30)26-23)24(28)32-14-15-12-22(27)33-20-13-16(31-2)10-11-17(15)20/h5-7,9-13,19H,3-4,8,14H2,1-2H3,(H,25,26)/t19-/m1/s1 |
| InChIKey | QVWJPBJIQRTKRF-LJQANCHMSA-N |
| XLogP | 3.14 |
| TPSA | 124.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.53 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|