C16H25ClN4O3S — CID 137052610
N-(3-aminopropyl)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]hexanamide;hydrochloride (PubChem CID 137052610) has the molecular formula C16H25ClN4O3S and a molecular weight of 388.92 g/mol. Its IUPAC name is N-(3-aminopropyl)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]hexanamide;hydrochloride.
| Compound Name | N-(3-aminopropyl)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]hexanamide;hydrochloride |
|---|---|
| PubChem CID | 137052610 |
| Molecular Formula | C16H25ClN4O3S |
| Molecular Weight | 388.92 g/mol |
| Exact Mass | 388.13 |
| IUPAC Name | N-(3-aminopropyl)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]hexanamide;hydrochloride |
| SMILES | CCCCC(/N=C1\NS(=O)(=O)c2ccccc21)C(=O)NCCCN.Cl |
| InChI | InChI=1S/C16H24N4O3S.ClH/c1-2-3-8-13(16(21)18-11-6-10-17)19-15-12-7-4-5-9-14(12)24(22,23)20-15;/h4-5,7,9,13H,2-3,6,8,10-11,17H2,1H3,(H,18,21)(H,19,20);1H |
| InChIKey | KMDDUVOUTXMKCP-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 113.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.92 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|