C19H29ClN4O3S — CID 137146556
N-(4-aminocyclohexyl)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]hexanamide;hydrochloride (PubChem CID 137146556) has the molecular formula C19H29ClN4O3S and a molecular weight of 428.99 g/mol. Its IUPAC name is N-(4-aminocyclohexyl)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]hexanamide;hydrochloride.
| Compound Name | N-(4-aminocyclohexyl)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]hexanamide;hydrochloride |
|---|---|
| PubChem CID | 137146556 |
| Molecular Formula | C19H29ClN4O3S |
| Molecular Weight | 428.99 g/mol |
| Exact Mass | 428.16 |
| IUPAC Name | N-(4-aminocyclohexyl)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]hexanamide;hydrochloride |
| SMILES | CCCCC(/N=C1\NS(=O)(=O)c2ccccc21)C(=O)NC1CCC(N)CC1.Cl |
| InChI | InChI=1S/C19H28N4O3S.ClH/c1-2-3-7-16(19(24)21-14-11-9-13(20)10-12-14)22-18-15-6-4-5-8-17(15)27(25,26)23-18;/h4-6,8,13-14,16H,2-3,7,9-12,20H2,1H3,(H,21,24)(H,22,23);1H |
| InChIKey | UQECJDIWVKOUBB-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 113.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.99 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|