C16H21N3O5S — CID 136942129
(2R)-2-[2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]hexanoylamino]propanoic acid (PubChem CID 136942129) has the molecular formula C16H21N3O5S and a molecular weight of 367.43 g/mol. Its IUPAC name is (2R)-2-[2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]hexanoylamino]propanoic acid.
| Compound Name | (2R)-2-[2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]hexanoylamino]propanoic acid |
|---|---|
| PubChem CID | 136942129 |
| Molecular Formula | C16H21N3O5S |
| Molecular Weight | 367.43 g/mol |
| Exact Mass | 367.12 |
| IUPAC Name | (2R)-2-[2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]hexanoylamino]propanoic acid |
| SMILES | CCCCC(/N=C1\NS(=O)(=O)c2ccccc21)C(=O)N[C@H](C)C(=O)O |
| InChI | InChI=1S/C16H21N3O5S/c1-3-4-8-12(15(20)17-10(2)16(21)22)18-14-11-7-5-6-9-13(11)25(23,24)19-14/h5-7,9-10,12H,3-4,8H2,1-2H3,(H,17,20)(H,18,19)(H,21,22)/t10-,12?/m1/s1 |
| InChIKey | PYLQCIVEZZYLCB-RWANSRKNSA-N |
| XLogP | 0.87 |
| TPSA | 124.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.43 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|