C22H27N3O4S — CID 136692957
(2S)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N-[(2R)-3-hydroxy-2-phenylpropyl]hexanamide (PubChem CID 136692957) has the molecular formula C22H27N3O4S and a molecular weight of 429.54 g/mol. Its IUPAC name is (2S)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N-[(2R)-3-hydroxy-2-phenylpropyl]hexanamide.
| Compound Name | (2S)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N-[(2R)-3-hydroxy-2-phenylpropyl]hexanamide |
|---|---|
| PubChem CID | 136692957 |
| Molecular Formula | C22H27N3O4S |
| Molecular Weight | 429.54 g/mol |
| Exact Mass | 429.17 |
| IUPAC Name | (2S)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N-[(2R)-3-hydroxy-2-phenylpropyl]hexanamide |
| SMILES | CCCC[C@H](/N=C1\NS(=O)(=O)c2ccccc21)C(=O)NC[C@H](CO)c1ccccc1 |
| InChI | InChI=1S/C22H27N3O4S/c1-2-3-12-19(22(27)23-14-17(15-26)16-9-5-4-6-10-16)24-21-18-11-7-8-13-20(18)30(28,29)25-21/h4-11,13,17,19,26H,2-3,12,14-15H2,1H3,(H,23,27)(H,24,25)/t17-,19+/m1/s1 |
| InChIKey | MEBKKBCPVDGIMB-MJGOQNOKSA-N |
| XLogP | 2.18 |
| TPSA | 107.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.54 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|