C22H25N3O3S — CID 135767246
N-(2,3-dihydro-1H-inden-5-yl)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]hexanamide (PubChem CID 135767246) has the molecular formula C22H25N3O3S and a molecular weight of 411.53 g/mol. Its IUPAC name is N-(2,3-dihydro-1H-inden-5-yl)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]hexanamide.
| Compound Name | N-(2,3-dihydro-1H-inden-5-yl)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]hexanamide |
|---|---|
| PubChem CID | 135767246 |
| Molecular Formula | C22H25N3O3S |
| Molecular Weight | 411.53 g/mol |
| Exact Mass | 411.16 |
| IUPAC Name | N-(2,3-dihydro-1H-inden-5-yl)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]hexanamide |
| SMILES | CCCCC(/N=C1\NS(=O)(=O)c2ccccc21)C(=O)Nc1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C22H25N3O3S/c1-2-3-10-19(22(26)23-17-13-12-15-7-6-8-16(15)14-17)24-21-18-9-4-5-11-20(18)29(27,28)25-21/h4-5,9,11-14,19H,2-3,6-8,10H2,1H3,(H,23,26)(H,24,25) |
| InChIKey | FYZLWJHNNSFOTI-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 87.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.53 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|