C23H28N4O6S — CID 135994884
2-methoxyethyl N-[3-[2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]hexanoylamino]phenyl]carbamate (PubChem CID 135994884) has the molecular formula C23H28N4O6S and a molecular weight of 488.57 g/mol. Its IUPAC name is 2-methoxyethyl N-[3-[2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]hexanoylamino]phenyl]carbamate.
| Compound Name | 2-methoxyethyl N-[3-[2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]hexanoylamino]phenyl]carbamate |
|---|---|
| PubChem CID | 135994884 |
| Molecular Formula | C23H28N4O6S |
| Molecular Weight | 488.57 g/mol |
| Exact Mass | 488.17 |
| IUPAC Name | 2-methoxyethyl N-[3-[2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]hexanoylamino]phenyl]carbamate |
| SMILES | CCCCC(/N=C1\NS(=O)(=O)c2ccccc21)C(=O)Nc1cccc(NC(=O)OCCOC)c1 |
| InChI | InChI=1S/C23H28N4O6S/c1-3-4-11-19(26-21-18-10-5-6-12-20(18)34(30,31)27-21)22(28)24-16-8-7-9-17(15-16)25-23(29)33-14-13-32-2/h5-10,12,15,19H,3-4,11,13-14H2,1-2H3,(H,24,28)(H,25,29)(H,26,27) |
| InChIKey | KUTITUJESWZDSG-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 135.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.57 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|