C19H19F2N3O3S — CID 135877124
(2S)-N-(3,4-difluorophenyl)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]hexanamide (PubChem CID 135877124) has the molecular formula C19H19F2N3O3S and a molecular weight of 407.44 g/mol. Its IUPAC name is (2S)-N-(3,4-difluorophenyl)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]hexanamide.
| Compound Name | (2S)-N-(3,4-difluorophenyl)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]hexanamide |
|---|---|
| PubChem CID | 135877124 |
| Molecular Formula | C19H19F2N3O3S |
| Molecular Weight | 407.44 g/mol |
| Exact Mass | 407.11 |
| IUPAC Name | (2S)-N-(3,4-difluorophenyl)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]hexanamide |
| SMILES | CCCC[C@H](/N=C1\NS(=O)(=O)c2ccccc21)C(=O)Nc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C19H19F2N3O3S/c1-2-3-7-16(19(25)22-12-9-10-14(20)15(21)11-12)23-18-13-6-4-5-8-17(13)28(26,27)24-18/h4-6,8-11,16H,2-3,7H2,1H3,(H,22,25)(H,23,24)/t16-/m0/s1 |
| InChIKey | NTMCJYDQJPOCEW-INIZCTEOSA-N |
| XLogP | 3.20 |
| TPSA | 87.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.44 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|