C16H17F2N5O3S2 — CID 135994898
N-[5-(difluoromethyl)-1,3,4-thiadiazol-2-yl]-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]hexanamide (PubChem CID 135994898) has the molecular formula C16H17F2N5O3S2 and a molecular weight of 429.47 g/mol. Its IUPAC name is N-[5-(difluoromethyl)-1,3,4-thiadiazol-2-yl]-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]hexanamide.
| Compound Name | N-[5-(difluoromethyl)-1,3,4-thiadiazol-2-yl]-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]hexanamide |
|---|---|
| PubChem CID | 135994898 |
| Molecular Formula | C16H17F2N5O3S2 |
| Molecular Weight | 429.47 g/mol |
| Exact Mass | 429.07 |
| IUPAC Name | N-[5-(difluoromethyl)-1,3,4-thiadiazol-2-yl]-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]hexanamide |
| SMILES | CCCCC(/N=C1\NS(=O)(=O)c2ccccc21)C(=O)Nc1nnc(C(F)F)s1 |
| InChI | InChI=1S/C16H17F2N5O3S2/c1-2-3-7-10(14(24)20-16-22-21-15(27-16)12(17)18)19-13-9-6-4-5-8-11(9)28(25,26)23-13/h4-6,8,10,12H,2-3,7H2,1H3,(H,19,23)(H,20,22,24) |
| InChIKey | LFYSNFGKKSFHTL-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 113.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.47 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|