C16H19N3O3S — CID 135776952
2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N-prop-2-ynylhexanamide (PubChem CID 135776952) has the molecular formula C16H19N3O3S and a molecular weight of 333.41 g/mol. Its IUPAC name is 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N-prop-2-ynylhexanamide.
| Compound Name | 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N-prop-2-ynylhexanamide |
|---|---|
| PubChem CID | 135776952 |
| Molecular Formula | C16H19N3O3S |
| Molecular Weight | 333.41 g/mol |
| Exact Mass | 333.11 |
| IUPAC Name | 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N-prop-2-ynylhexanamide |
| SMILES | C#CCNC(=O)C(CCCC)/N=C1\NS(=O)(=O)c2ccccc21 |
| InChI | InChI=1S/C16H19N3O3S/c1-3-5-9-13(16(20)17-11-4-2)18-15-12-8-6-7-10-14(12)23(21,22)19-15/h2,6-8,10,13H,3,5,9,11H2,1H3,(H,17,20)(H,18,19) |
| InChIKey | SHBYQORDLWZYRD-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 87.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.41 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|