C18H26N4O4S — CID 135908790
2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N-[1-(ethylamino)-1-oxopropan-2-yl]hexanamide (PubChem CID 135908790) has the molecular formula C18H26N4O4S and a molecular weight of 394.50 g/mol. Its IUPAC name is 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N-[1-(ethylamino)-1-oxopropan-2-yl]hexanamide.
| Compound Name | 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N-[1-(ethylamino)-1-oxopropan-2-yl]hexanamide |
|---|---|
| PubChem CID | 135908790 |
| Molecular Formula | C18H26N4O4S |
| Molecular Weight | 394.50 g/mol |
| Exact Mass | 394.17 |
| IUPAC Name | 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N-[1-(ethylamino)-1-oxopropan-2-yl]hexanamide |
| SMILES | CCCCC(/N=C1\NS(=O)(=O)c2ccccc21)C(=O)NC(C)C(=O)NCC |
| InChI | InChI=1S/C18H26N4O4S/c1-4-6-10-14(18(24)20-12(3)17(23)19-5-2)21-16-13-9-7-8-11-15(13)27(25,26)22-16/h7-9,11-12,14H,4-6,10H2,1-3H3,(H,19,23)(H,20,24)(H,21,22) |
| InChIKey | SBYQMVJKRVOBGB-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 116.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.50 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|