C21H24N6O3S — CID 135951574
(2R)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]hexanamide (PubChem CID 135951574) has the molecular formula C21H24N6O3S and a molecular weight of 440.53 g/mol. Its IUPAC name is (2R)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]hexanamide.
| Compound Name | (2R)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]hexanamide |
|---|---|
| PubChem CID | 135951574 |
| Molecular Formula | C21H24N6O3S |
| Molecular Weight | 440.53 g/mol |
| Exact Mass | 440.16 |
| IUPAC Name | (2R)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]hexanamide |
| SMILES | CCCC[C@@H](/N=C1\NS(=O)(=O)c2ccccc21)C(=O)NCCc1nnc2ccccn12 |
| InChI | InChI=1S/C21H24N6O3S/c1-2-3-9-16(23-20-15-8-4-5-10-17(15)31(29,30)26-20)21(28)22-13-12-19-25-24-18-11-6-7-14-27(18)19/h4-8,10-11,14,16H,2-3,9,12-13H2,1H3,(H,22,28)(H,23,26)/t16-/m1/s1 |
| InChIKey | VYQJLAXQYWXDDM-MRXNPFEDSA-N |
| XLogP | 1.69 |
| TPSA | 117.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.53 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|