C22H25F2N3O5S — CID 135973912
N-[[3-(difluoromethoxy)-4-methoxyphenyl]methyl]-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]hexanamide (PubChem CID 135973912) has the molecular formula C22H25F2N3O5S and a molecular weight of 481.52 g/mol. Its IUPAC name is N-[[3-(difluoromethoxy)-4-methoxyphenyl]methyl]-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]hexanamide.
| Compound Name | N-[[3-(difluoromethoxy)-4-methoxyphenyl]methyl]-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]hexanamide |
|---|---|
| PubChem CID | 135973912 |
| Molecular Formula | C22H25F2N3O5S |
| Molecular Weight | 481.52 g/mol |
| Exact Mass | 481.15 |
| IUPAC Name | N-[[3-(difluoromethoxy)-4-methoxyphenyl]methyl]-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]hexanamide |
| SMILES | CCCCC(/N=C1\NS(=O)(=O)c2ccccc21)C(=O)NCc1ccc(OC)c(OC(F)F)c1 |
| InChI | InChI=1S/C22H25F2N3O5S/c1-3-4-8-16(26-20-15-7-5-6-9-19(15)33(29,30)27-20)21(28)25-13-14-10-11-17(31-2)18(12-14)32-22(23)24/h5-7,9-12,16,22H,3-4,8,13H2,1-2H3,(H,25,28)(H,26,27) |
| InChIKey | GWMCSDRQAKCSNM-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 106.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.52 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|