C23H26N6O4S — CID 135887763
(2R)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N'-(3-ethyl-4-oxoquinazolin-2-yl)hexanehydrazide (PubChem CID 135887763) has the molecular formula C23H26N6O4S and a molecular weight of 482.57 g/mol. Its IUPAC name is (2R)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N'-(3-ethyl-4-oxoquinazolin-2-yl)hexanehydrazide.
| Compound Name | (2R)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N'-(3-ethyl-4-oxoquinazolin-2-yl)hexanehydrazide |
|---|---|
| PubChem CID | 135887763 |
| Molecular Formula | C23H26N6O4S |
| Molecular Weight | 482.57 g/mol |
| Exact Mass | 482.17 |
| IUPAC Name | (2R)-2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N'-(3-ethyl-4-oxoquinazolin-2-yl)hexanehydrazide |
| SMILES | CCCC[C@@H](/N=C1\NS(=O)(=O)c2ccccc21)C(=O)NNc1nc2ccccc2c(=O)n1CC |
| InChI | InChI=1S/C23H26N6O4S/c1-3-5-12-18(24-20-16-11-7-9-14-19(16)34(32,33)28-20)21(30)26-27-23-25-17-13-8-6-10-15(17)22(31)29(23)4-2/h6-11,13-14,18H,3-5,12H2,1-2H3,(H,24,28)(H,25,27)(H,26,30)/t18-/m1/s1 |
| InChIKey | YNJFORPESDKVGD-GOSISDBHSA-N |
| XLogP | 2.16 |
| TPSA | 134.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.57 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|