C17H23N5O3 — CID 24574726
N-[1-[2-(3-ethyl-4-oxoquinazolin-2-yl)hydrazinyl]-3-methyl-1-oxobutan-2-yl]acetamide (PubChem CID 24574726) has the molecular formula C17H23N5O3 and a molecular weight of 345.40 g/mol. Its IUPAC name is N-[1-[2-(3-ethyl-4-oxoquinazolin-2-yl)hydrazinyl]-3-methyl-1-oxobutan-2-yl]acetamide.
| Compound Name | N-[1-[2-(3-ethyl-4-oxoquinazolin-2-yl)hydrazinyl]-3-methyl-1-oxobutan-2-yl]acetamide |
|---|---|
| PubChem CID | 24574726 |
| Molecular Formula | C17H23N5O3 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.18 |
| IUPAC Name | N-[1-[2-(3-ethyl-4-oxoquinazolin-2-yl)hydrazinyl]-3-methyl-1-oxobutan-2-yl]acetamide |
| SMILES | CCn1c(NNC(=O)C(NC(C)=O)C(C)C)nc2ccccc2c1=O |
| InChI | InChI=1S/C17H23N5O3/c1-5-22-16(25)12-8-6-7-9-13(12)19-17(22)21-20-15(24)14(10(2)3)18-11(4)23/h6-10,14H,5H2,1-4H3,(H,18,23)(H,19,21)(H,20,24) |
| InChIKey | XDNQAMMRMPACHA-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 105.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|