C18H16Cl2N4O2 — CID 51251509
2-(2,6-dichlorophenyl)-N'-(3-ethyl-4-oxoquinazolin-2-yl)acetohydrazide (PubChem CID 51251509) has the molecular formula C18H16Cl2N4O2 and a molecular weight of 391.26 g/mol. Its IUPAC name is 2-(2,6-dichlorophenyl)-N'-(3-ethyl-4-oxoquinazolin-2-yl)acetohydrazide.
| Compound Name | 2-(2,6-dichlorophenyl)-N'-(3-ethyl-4-oxoquinazolin-2-yl)acetohydrazide |
|---|---|
| PubChem CID | 51251509 |
| Molecular Formula | C18H16Cl2N4O2 |
| Molecular Weight | 391.26 g/mol |
| Exact Mass | 390.07 |
| IUPAC Name | 2-(2,6-dichlorophenyl)-N'-(3-ethyl-4-oxoquinazolin-2-yl)acetohydrazide |
| SMILES | CCn1c(NNC(=O)Cc2c(Cl)cccc2Cl)nc2ccccc2c1=O |
| InChI | InChI=1S/C18H16Cl2N4O2/c1-2-24-17(26)11-6-3-4-9-15(11)21-18(24)23-22-16(25)10-12-13(19)7-5-8-14(12)20/h3-9H,2,10H2,1H3,(H,21,23)(H,22,25) |
| InChIKey | ZRTDZROIXYBERL-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.26 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|