C19H19ClN4O3 — CID 55576050
2-(2-chlorophenoxy)-N'-(3-ethyl-4-oxoquinazolin-2-yl)propanehydrazide (PubChem CID 55576050) has the molecular formula C19H19ClN4O3 and a molecular weight of 386.84 g/mol. Its IUPAC name is 2-(2-chlorophenoxy)-N'-(3-ethyl-4-oxoquinazolin-2-yl)propanehydrazide.
| Compound Name | 2-(2-chlorophenoxy)-N'-(3-ethyl-4-oxoquinazolin-2-yl)propanehydrazide |
|---|---|
| PubChem CID | 55576050 |
| Molecular Formula | C19H19ClN4O3 |
| Molecular Weight | 386.84 g/mol |
| Exact Mass | 386.11 |
| IUPAC Name | 2-(2-chlorophenoxy)-N'-(3-ethyl-4-oxoquinazolin-2-yl)propanehydrazide |
| SMILES | CCn1c(NNC(=O)C(C)Oc2ccccc2Cl)nc2ccccc2c1=O |
| InChI | InChI=1S/C19H19ClN4O3/c1-3-24-18(26)13-8-4-6-10-15(13)21-19(24)23-22-17(25)12(2)27-16-11-7-5-9-14(16)20/h4-12H,3H2,1-2H3,(H,21,23)(H,22,25) |
| InChIKey | BTWBJXUSVWDIIF-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.84 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|