C21H22N4O3S2 — CID 24598241
2-[2-(1,3-dithiolan-2-yl)phenoxy]-N'-(3-ethyl-4-oxoquinazolin-2-yl)acetohydrazide (PubChem CID 24598241) has the molecular formula C21H22N4O3S2 and a molecular weight of 442.57 g/mol. Its IUPAC name is 2-[2-(1,3-dithiolan-2-yl)phenoxy]-N'-(3-ethyl-4-oxoquinazolin-2-yl)acetohydrazide.
| Compound Name | 2-[2-(1,3-dithiolan-2-yl)phenoxy]-N'-(3-ethyl-4-oxoquinazolin-2-yl)acetohydrazide |
|---|---|
| PubChem CID | 24598241 |
| Molecular Formula | C21H22N4O3S2 |
| Molecular Weight | 442.57 g/mol |
| Exact Mass | 442.11 |
| IUPAC Name | 2-[2-(1,3-dithiolan-2-yl)phenoxy]-N'-(3-ethyl-4-oxoquinazolin-2-yl)acetohydrazide |
| SMILES | CCn1c(NNC(=O)COc2ccccc2C2SCCS2)nc2ccccc2c1=O |
| InChI | InChI=1S/C21H22N4O3S2/c1-2-25-19(27)14-7-3-5-9-16(14)22-21(25)24-23-18(26)13-28-17-10-6-4-8-15(17)20-29-11-12-30-20/h3-10,20H,2,11-13H2,1H3,(H,22,24)(H,23,26) |
| InChIKey | OXKPECNHYYPNNT-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.57 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|