C21H29N5O3 — CID 18227266
1-(2,2-dimethylpropanoyl)-N'-(3-ethyl-4-oxoquinazolin-2-yl)piperidine-4-carbohydrazide (PubChem CID 18227266) has the molecular formula C21H29N5O3 and a molecular weight of 399.50 g/mol. Its IUPAC name is 1-(2,2-dimethylpropanoyl)-N'-(3-ethyl-4-oxoquinazolin-2-yl)piperidine-4-carbohydrazide.
| Compound Name | 1-(2,2-dimethylpropanoyl)-N'-(3-ethyl-4-oxoquinazolin-2-yl)piperidine-4-carbohydrazide |
|---|---|
| PubChem CID | 18227266 |
| Molecular Formula | C21H29N5O3 |
| Molecular Weight | 399.50 g/mol |
| Exact Mass | 399.23 |
| IUPAC Name | 1-(2,2-dimethylpropanoyl)-N'-(3-ethyl-4-oxoquinazolin-2-yl)piperidine-4-carbohydrazide |
| SMILES | CCn1c(NNC(=O)C2CCN(C(=O)C(C)(C)C)CC2)nc2ccccc2c1=O |
| InChI | InChI=1S/C21H29N5O3/c1-5-26-18(28)15-8-6-7-9-16(15)22-20(26)24-23-17(27)14-10-12-25(13-11-14)19(29)21(2,3)4/h6-9,14H,5,10-13H2,1-4H3,(H,22,24)(H,23,27) |
| InChIKey | NCTSUMLLTUZITF-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 96.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.50 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|