C22H25N5O4S — CID 51925984
(2R)-1-(benzenesulfonyl)-N'-(3-ethyl-4-oxoquinazolin-2-yl)piperidine-2-carbohydrazide (PubChem CID 51925984) has the molecular formula C22H25N5O4S and a molecular weight of 455.54 g/mol. Its IUPAC name is (2R)-1-(benzenesulfonyl)-N'-(3-ethyl-4-oxoquinazolin-2-yl)piperidine-2-carbohydrazide.
| Compound Name | (2R)-1-(benzenesulfonyl)-N'-(3-ethyl-4-oxoquinazolin-2-yl)piperidine-2-carbohydrazide |
|---|---|
| PubChem CID | 51925984 |
| Molecular Formula | C22H25N5O4S |
| Molecular Weight | 455.54 g/mol |
| Exact Mass | 455.16 |
| IUPAC Name | (2R)-1-(benzenesulfonyl)-N'-(3-ethyl-4-oxoquinazolin-2-yl)piperidine-2-carbohydrazide |
| SMILES | CCn1c(NNC(=O)[C@H]2CCCCN2S(=O)(=O)c2ccccc2)nc2ccccc2c1=O |
| InChI | InChI=1S/C22H25N5O4S/c1-2-26-21(29)17-12-6-7-13-18(17)23-22(26)25-24-20(28)19-14-8-9-15-27(19)32(30,31)16-10-4-3-5-11-16/h3-7,10-13,19H,2,8-9,14-15H2,1H3,(H,23,25)(H,24,28)/t19-/m1/s1 |
| InChIKey | PDKBTLXVCWILBN-LJQANCHMSA-N |
| XLogP | 2.10 |
| TPSA | 113.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.54 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|