C20H19N5O2 — CID 46554469
N'-(3-ethyl-4-oxoquinazolin-2-yl)-1-methylindole-3-carbohydrazide (PubChem CID 46554469) has the molecular formula C20H19N5O2 and a molecular weight of 361.41 g/mol. Its IUPAC name is N'-(3-ethyl-4-oxoquinazolin-2-yl)-1-methylindole-3-carbohydrazide.
| Compound Name | N'-(3-ethyl-4-oxoquinazolin-2-yl)-1-methylindole-3-carbohydrazide |
|---|---|
| PubChem CID | 46554469 |
| Molecular Formula | C20H19N5O2 |
| Molecular Weight | 361.41 g/mol |
| Exact Mass | 361.15 |
| IUPAC Name | N'-(3-ethyl-4-oxoquinazolin-2-yl)-1-methylindole-3-carbohydrazide |
| SMILES | CCn1c(NNC(=O)c2cn(C)c3ccccc23)nc2ccccc2c1=O |
| InChI | InChI=1S/C20H19N5O2/c1-3-25-19(27)14-9-4-6-10-16(14)21-20(25)23-22-18(26)15-12-24(2)17-11-7-5-8-13(15)17/h4-12H,3H2,1-2H3,(H,21,23)(H,22,26) |
| InChIKey | RKIUQFIMVUYHAA-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 80.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.41 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|