C18H20N4O2S — CID 18139295
5-ethyl-N'-(3-ethyl-4-oxoquinazolin-2-yl)-4-methylthiophene-2-carbohydrazide (PubChem CID 18139295) has the molecular formula C18H20N4O2S and a molecular weight of 356.45 g/mol. Its IUPAC name is 5-ethyl-N'-(3-ethyl-4-oxoquinazolin-2-yl)-4-methylthiophene-2-carbohydrazide.
| Compound Name | 5-ethyl-N'-(3-ethyl-4-oxoquinazolin-2-yl)-4-methylthiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 18139295 |
| Molecular Formula | C18H20N4O2S |
| Molecular Weight | 356.45 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | 5-ethyl-N'-(3-ethyl-4-oxoquinazolin-2-yl)-4-methylthiophene-2-carbohydrazide |
| SMILES | CCc1sc(C(=O)NNc2nc3ccccc3c(=O)n2CC)cc1C |
| InChI | InChI=1S/C18H20N4O2S/c1-4-14-11(3)10-15(25-14)16(23)20-21-18-19-13-9-7-6-8-12(13)17(24)22(18)5-2/h6-10H,4-5H2,1-3H3,(H,19,21)(H,20,23) |
| InChIKey | NWXYGKSUPUSTEU-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.45 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|