C20H23N5O4S — CID 24598230
5-[[(3-ethyl-4-oxoquinazolin-2-yl)amino]carbamoyl]-N,2,3-trimethylbenzenesulfonamide (PubChem CID 24598230) has the molecular formula C20H23N5O4S and a molecular weight of 429.50 g/mol. Its IUPAC name is 5-[[(3-ethyl-4-oxoquinazolin-2-yl)amino]carbamoyl]-N,2,3-trimethylbenzenesulfonamide.
| Compound Name | 5-[[(3-ethyl-4-oxoquinazolin-2-yl)amino]carbamoyl]-N,2,3-trimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 24598230 |
| Molecular Formula | C20H23N5O4S |
| Molecular Weight | 429.50 g/mol |
| Exact Mass | 429.15 |
| IUPAC Name | 5-[[(3-ethyl-4-oxoquinazolin-2-yl)amino]carbamoyl]-N,2,3-trimethylbenzenesulfonamide |
| SMILES | CCn1c(NNC(=O)c2cc(C)c(C)c(S(=O)(=O)NC)c2)nc2ccccc2c1=O |
| InChI | InChI=1S/C20H23N5O4S/c1-5-25-19(27)15-8-6-7-9-16(15)22-20(25)24-23-18(26)14-10-12(2)13(3)17(11-14)30(28,29)21-4/h6-11,21H,5H2,1-4H3,(H,22,24)(H,23,26) |
| InChIKey | FXWYFLFHBLLPBX-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 122.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.50 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|