C17H22N4O2 — CID 18139328
2-cyclopentyl-N'-(3-ethyl-4-oxoquinazolin-2-yl)acetohydrazide (PubChem CID 18139328) has the molecular formula C17H22N4O2 and a molecular weight of 314.39 g/mol. Its IUPAC name is 2-cyclopentyl-N'-(3-ethyl-4-oxoquinazolin-2-yl)acetohydrazide.
| Compound Name | 2-cyclopentyl-N'-(3-ethyl-4-oxoquinazolin-2-yl)acetohydrazide |
|---|---|
| PubChem CID | 18139328 |
| Molecular Formula | C17H22N4O2 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | 2-cyclopentyl-N'-(3-ethyl-4-oxoquinazolin-2-yl)acetohydrazide |
| SMILES | CCn1c(NNC(=O)CC2CCCC2)nc2ccccc2c1=O |
| InChI | InChI=1S/C17H22N4O2/c1-2-21-16(23)13-9-5-6-10-14(13)18-17(21)20-19-15(22)11-12-7-3-4-8-12/h5-6,9-10,12H,2-4,7-8,11H2,1H3,(H,18,20)(H,19,22) |
| InChIKey | MHJMRKAZYZUUGF-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|