C21H30N4O2 — CID 17475140
4-butyl-N'-(3-ethyl-4-oxoquinazolin-2-yl)cyclohexane-1-carbohydrazide (PubChem CID 17475140) has the molecular formula C21H30N4O2 and a molecular weight of 370.50 g/mol. Its IUPAC name is 4-butyl-N'-(3-ethyl-4-oxoquinazolin-2-yl)cyclohexane-1-carbohydrazide.
| Compound Name | 4-butyl-N'-(3-ethyl-4-oxoquinazolin-2-yl)cyclohexane-1-carbohydrazide |
|---|---|
| PubChem CID | 17475140 |
| Molecular Formula | C21H30N4O2 |
| Molecular Weight | 370.50 g/mol |
| Exact Mass | 370.24 |
| IUPAC Name | 4-butyl-N'-(3-ethyl-4-oxoquinazolin-2-yl)cyclohexane-1-carbohydrazide |
| SMILES | CCCCC1CCC(C(=O)NNc2nc3ccccc3c(=O)n2CC)CC1 |
| InChI | InChI=1S/C21H30N4O2/c1-3-5-8-15-11-13-16(14-12-15)19(26)23-24-21-22-18-10-7-6-9-17(18)20(27)25(21)4-2/h6-7,9-10,15-16H,3-5,8,11-14H2,1-2H3,(H,22,24)(H,23,26) |
| InChIKey | LLYAALZPXIRPES-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.50 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|