C19H27N3O — CID 3346804
4-butyl-N-(1-methylbenzimidazol-2-yl)cyclohexane-1-carboxamide (PubChem CID 3346804) has the molecular formula C19H27N3O and a molecular weight of 313.44 g/mol. Its IUPAC name is 4-butyl-N-(1-methylbenzimidazol-2-yl)cyclohexane-1-carboxamide.
| Compound Name | 4-butyl-N-(1-methylbenzimidazol-2-yl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 3346804 |
| Molecular Formula | C19H27N3O |
| Molecular Weight | 313.44 g/mol |
| Exact Mass | 313.22 |
| IUPAC Name | 4-butyl-N-(1-methylbenzimidazol-2-yl)cyclohexane-1-carboxamide |
| SMILES | CCCCC1CCC(C(=O)Nc2nc3ccccc3n2C)CC1 |
| InChI | InChI=1S/C19H27N3O/c1-3-4-7-14-10-12-15(13-11-14)18(23)21-19-20-16-8-5-6-9-17(16)22(19)2/h5-6,8-9,14-15H,3-4,7,10-13H2,1-2H3,(H,20,21,23) |
| InChIKey | LBAHUIORQLCNHJ-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.44 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |