C23H28N4O3S — CID 55806336
1-butylsulfonyl-N-(1-phenylbenzimidazol-2-yl)piperidine-4-carboxamide (PubChem CID 55806336) has the molecular formula C23H28N4O3S and a molecular weight of 440.57 g/mol. Its IUPAC name is 1-butylsulfonyl-N-(1-phenylbenzimidazol-2-yl)piperidine-4-carboxamide.
| Compound Name | 1-butylsulfonyl-N-(1-phenylbenzimidazol-2-yl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 55806336 |
| Molecular Formula | C23H28N4O3S |
| Molecular Weight | 440.57 g/mol |
| Exact Mass | 440.19 |
| IUPAC Name | 1-butylsulfonyl-N-(1-phenylbenzimidazol-2-yl)piperidine-4-carboxamide |
| SMILES | CCCCS(=O)(=O)N1CCC(C(=O)Nc2nc3ccccc3n2-c2ccccc2)CC1 |
| InChI | InChI=1S/C23H28N4O3S/c1-2-3-17-31(29,30)26-15-13-18(14-16-26)22(28)25-23-24-20-11-7-8-12-21(20)27(23)19-9-5-4-6-10-19/h4-12,18H,2-3,13-17H2,1H3,(H,24,25,28) |
| InChIKey | BJISFKRPPYSAIH-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.57 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |