C18H26N4O3S — CID 34052499
1-ethylsulfonyl-N-(1-propylbenzimidazol-2-yl)piperidine-4-carboxamide (PubChem CID 34052499) has the molecular formula C18H26N4O3S and a molecular weight of 378.50 g/mol. Its IUPAC name is 1-ethylsulfonyl-N-(1-propylbenzimidazol-2-yl)piperidine-4-carboxamide.
| Compound Name | 1-ethylsulfonyl-N-(1-propylbenzimidazol-2-yl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 34052499 |
| Molecular Formula | C18H26N4O3S |
| Molecular Weight | 378.50 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | 1-ethylsulfonyl-N-(1-propylbenzimidazol-2-yl)piperidine-4-carboxamide |
| SMILES | CCCn1c(NC(=O)C2CCN(S(=O)(=O)CC)CC2)nc2ccccc21 |
| InChI | InChI=1S/C18H26N4O3S/c1-3-11-22-16-8-6-5-7-15(16)19-18(22)20-17(23)14-9-12-21(13-10-14)26(24,25)4-2/h5-8,14H,3-4,9-13H2,1-2H3,(H,19,20,23) |
| InChIKey | DFPQWTISDMUTBP-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.50 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |